CAS 20945-65-7 appears in our catalog under these names: 2-Chloro-4-(methylsulfonyl)phenol, 95%, 2–Chloro–4–(methylsulfonyl)phenol, 2-Chloro-4-(methylsulfonyl)phenol 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 10g, 25g, 5g, 1g, 100mg.
2-chloro-4-methylsulfonylphenol (CAS 20945-65-7) is a chemical compound with the molecular formula C7H7ClO3S and a molecular weight of 206.65 g/mol. IUPAC name: 2-chloro-4-methylsulfonylphenol. InChIKey: NKCJTSDDCIJRLT-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO3S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 2-chloro-4-methylsulfonylphenol |
| InChIKey | NKCJTSDDCIJRLT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)O)Cl |
Computed by PubChem (NCBI)