3-Methylbenzenesulfonic acid hydrate, 98%
cas: 312619-56-0 — see every product listed under this CAS number, including other names
3-Methylbenzenesulfonic acid hydrate, 98% (CAS 312619-56-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1329955-250mg |
| cas | 312619-56-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 2128.12 Pln | |
| Ambeed | 10g | 3368.56 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 514.29 Pln | |
| BLDpharm | 5g | 2291.44 Pln | |
| BLDpharm | 10g | 3624.30 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 482.14 Pln | |
| Fluorochem | 5g | 2090.95 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-methylbenzenesulfonic acid;hydrate (CAS 312619-56-0) is a chemical compound with the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. IUPAC name: 3-methylbenzenesulfonic acid;hydrate. InChIKey: GHLYGGIKYFLYTH-UHFFFAOYSA-N.
| Molecular formula | C7H10O4S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 3-methylbenzenesulfonic acid;hydrate |
| InChIKey | GHLYGGIKYFLYTH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)S(=O)(=O)O.O |
Computed by PubChem (NCBI)
Synonyms:
m-Toluenesulfonic acid hydrate, 3-methylbenzenesulfonic acid;hydrate, 3-Methylbenzenesulfonic acid hydrate, M-TOLUENESULFONIC ACID MONOHYDRATE, 3-methylbenzene-1-sulfonic acid hydrate, 3-?Methylbenzenesulfoni?c Acid Monohydrate, m-Toluenesulfonic acid 1-hydrate, 3-Methylbenzenesulfonic acid monohydrate, Paroxetine Impurity 34, M-TOLUENESULPHONIC ACID MONOHYDRATE