Products 1340163-36-1
CAS 1340163-36-1 is the registry number for 5-Thiaspiro[2.4]heptane-1-carboxylic acid 5,5-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,5-dioxo-5lambda6-thiaspiro[2.4]heptane-2-carboxylic acid (CAS 1340163-36-1) is a chemical compound with the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. IUPAC name: 5,5-dioxo-5lambda6-thiaspiro[2.4]heptane-2-carboxylic acid. InChIKey: IZOPHMFUSDFTSZ-UHFFFAOYSA-N.
| Molecular formula | C7H10O4S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 5,5-dioxo-5lambda6-thiaspiro[2.4]heptane-2-carboxylic acid |
| InChIKey | IZOPHMFUSDFTSZ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC12CC2C(=O)O |
Computed by PubChem (NCBI)