Products 167011-33-8

CAS 167011-33-8 is the registry number for Methyl 5,6-dihydro-2H-thiopyran-3-carboxylate 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 1,1-dioxo-3,6-dihydro-2H-thiopyran-5-carboxylate (CAS 167011-33-8) is a chemical compound with the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. IUPAC name: methyl 1,1-dioxo-3,6-dihydro-2H-thiopyran-5-carboxylate. InChIKey: UFJJAMBKRMAAJP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10O4S
Molecular weight190.22 g/mol
IUPAC namemethyl 1,1-dioxo-3,6-dihydro-2H-thiopyran-5-carboxylate
InChIKeyUFJJAMBKRMAAJP-UHFFFAOYSA-N
SMILESCOC(=O)C1=CCCS(=O)(=O)C1

Computed by PubChem (NCBI)