Products 1344846-39-4
CAS 1344846-39-4 is the registry number for 2-(1,1-Dioxidodihydro-2H-thiopyran-3(4H)-ylidene)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2E)-2-(1,1-dioxothian-3-ylidene)acetic acid (CAS 1344846-39-4) is a chemical compound with the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. IUPAC name: (2E)-2-(1,1-dioxothian-3-ylidene)acetic acid. InChIKey: MHGUCEKDNYXSIF-GQCTYLIASA-N.
| Molecular formula | C7H10O4S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | (2E)-2-(1,1-dioxothian-3-ylidene)acetic acid |
| InChIKey | MHGUCEKDNYXSIF-GQCTYLIASA-N |
| SMILES | C1C/C(=C\C(=O)O)/CS(=O)(=O)C1 |
Computed by PubChem (NCBI)