Products 15486-54-1

CAS 15486-54-1 is the registry number for 5-Hydroxy-2,6-norbornanesultone, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonan-2-ol (CAS 15486-54-1) is a chemical compound with the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. IUPAC name: 5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonan-2-ol. InChIKey: FINFXYAYRYNUNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10O4S
Molecular weight190.22 g/mol
IUPAC name5,5-dioxo-4-oxa-5lambda6-thiatricyclo[4.2.1.03,7]nonan-2-ol
InChIKeyFINFXYAYRYNUNQ-UHFFFAOYSA-N
SMILESC1C2CC3C1C(C2O)OS3(=O)=O

Computed by PubChem (NCBI)