Products 312619-56-0
CAS 312619-56-0 appears in our catalog under these names: M-Toluenesulfonic acid monohydrate, 95%, 3-Methylbenzenesulfonic Acid Monohydrate, >95% (HPLC), m-Toluenesulfonic acid monohydrate, 97% , 3-Methylbenzenesulfonic acid hydrate 98%, 3-Methylbenzenesulfonic acid hydrate, 98%. Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 500mg, 250mg, 10g.
3-methylbenzenesulfonic acid;hydrate (CAS 312619-56-0) is a chemical compound with the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. IUPAC name: 3-methylbenzenesulfonic acid;hydrate. InChIKey: GHLYGGIKYFLYTH-UHFFFAOYSA-N.
| Molecular formula | C7H10O4S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 3-methylbenzenesulfonic acid;hydrate |
| InChIKey | GHLYGGIKYFLYTH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)S(=O)(=O)O.O |
Computed by PubChem (NCBI)
Synonyms:
m-Toluenesulfonic acid hydrate, 3-methylbenzenesulfonic acid;hydrate, 3-Methylbenzenesulfonic acid hydrate, M-TOLUENESULFONIC ACID MONOHYDRATE, 3-methylbenzene-1-sulfonic acid hydrate, 3-?Methylbenzenesulfoni?c Acid Monohydrate, m-Toluenesulfonic acid 1-hydrate, 3-Methylbenzenesulfonic acid monohydrate, Paroxetine Impurity 34, M-TOLUENESULPHONIC ACID MONOHYDRATE