CAS 6192-52-5 appears in our catalog under these names: p-Toluenesulfonic acid monohydrate, 97%, Anastrozole EP Impurity F Monohydrate (Escitalopram EP Impurity J Monohydrate, Lisinopril EP Impurity B Monohydrate, Sultamicillin EP Impurity B Monohydrate, Tizanidine EP Impurity I Monohydrate), Lisinopril Impurity 2(Lisinopril EP Impurity B), Anastrozole Impurity 11(EP Impurity F), 4-Methylbenzenesulfonic Acid Monohydrate, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: 1kg, 100g, 500g, on request, 10mg, 25mg, 50mg, 100mg.
4-methylbenzenesulfonic acid;hydrate (CAS 6192-52-5) is a chemical compound with the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;hydrate. InChIKey: KJIFKLIQANRMOU-UHFFFAOYSA-N.
| Molecular formula | C7H10O4S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;hydrate |
| InChIKey | KJIFKLIQANRMOU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.O |
Computed by PubChem (NCBI)