CAS 2344680-35-7 is the registry number for 2-{Bicyclo(1.1.1)pentane-1-sulfonyl}acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1-bicyclo[1.1.1]pentanylsulfonyl)acetic acid (CAS 2344680-35-7) is a chemical compound with the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. IUPAC name: 2-(1-bicyclo[1.1.1]pentanylsulfonyl)acetic acid. InChIKey: QBXKDNVQOKRKFW-UHFFFAOYSA-N.
| Molecular formula | C7H10O4S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 2-(1-bicyclo[1.1.1]pentanylsulfonyl)acetic acid |
| InChIKey | QBXKDNVQOKRKFW-UHFFFAOYSA-N |
| SMILES | C1C2CC1(C2)S(=O)(=O)CC(=O)O |
Computed by PubChem (NCBI)