Products 2344680-35-7

CAS 2344680-35-7 is the registry number for 2-{Bicyclo(1.1.1)pentane-1-sulfonyl}acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(1-bicyclo[1.1.1]pentanylsulfonyl)acetic acid (CAS 2344680-35-7) is a chemical compound with the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. IUPAC name: 2-(1-bicyclo[1.1.1]pentanylsulfonyl)acetic acid. InChIKey: QBXKDNVQOKRKFW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10O4S
Molecular weight190.22 g/mol
IUPAC name2-(1-bicyclo[1.1.1]pentanylsulfonyl)acetic acid
InChIKeyQBXKDNVQOKRKFW-UHFFFAOYSA-N
SMILESC1C2CC1(C2)S(=O)(=O)CC(=O)O

Computed by PubChem (NCBI)