CAS 2092286-66-1 appears in our catalog under these names: 2-Thiaspiro(3.3)heptane-6-carboxylic acid 2,2-dioxide, 95%, 2-​Thiaspiro(3.3)​heptane-​6-​carboxylic acid 2,​2-​dioxide, 2,2-dioxo-2lambda6-thiaspiro[3.3]heptane-6-carboxylic acid, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
2,2-dioxo-2lambda6-thiaspiro[3.3]heptane-6-carboxylic acid (CAS 2092286-66-1) is a chemical compound with the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. IUPAC name: 2,2-dioxo-2lambda6-thiaspiro[3.3]heptane-6-carboxylic acid. InChIKey: AUUBVSVUCMPSKW-UHFFFAOYSA-N.
| Molecular formula | C7H10O4S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 2,2-dioxo-2lambda6-thiaspiro[3.3]heptane-6-carboxylic acid |
| InChIKey | AUUBVSVUCMPSKW-UHFFFAOYSA-N |
| SMILES | C1C(CC12CS(=O)(=O)C2)C(=O)O |
Computed by PubChem (NCBI)