cas: 126318-27-2 — see every product listed under this CAS number, including other names
3-Nitrobenzofuran-5-ol, 98% (CAS 126318-27-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F747567-1G |
| cas | 126318-27-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1195.43 Pln | |
| Fluorochem | 10g | 2236.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-nitro-1-benzofuran-5-ol (CAS 126318-27-2) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 3-nitro-1-benzofuran-5-ol. InChIKey: ZQPBTBWGCWHIGU-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 3-nitro-1-benzofuran-5-ol |
| InChIKey | ZQPBTBWGCWHIGU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=CO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)