cas: 935269-27-5 — see every product listed under this CAS number, including other names
3-Oxoisoindoline-4-carboxylic acid, 96% (CAS 935269-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g, 500mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QI-8836-100mg |
| cas | 935269-27-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 500mg | 924.69 Pln | |
| Fluorochem | 1g | 1591.12 Pln | |
| Fluorochem | 5g | 7359.93 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-oxo-1,2-dihydroisoindole-4-carboxylic acid (CAS 935269-27-5) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 3-oxo-1,2-dihydroisoindole-4-carboxylic acid. InChIKey: SONYZPKBPBFLSS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-oxo-1,2-dihydroisoindole-4-carboxylic acid |
| InChIKey | SONYZPKBPBFLSS-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)C(=O)O)C(=O)N1 |
Computed by PubChem (NCBI)