cas: 935269-27-5 — see every product listed under this CAS number, including other names
3-Oxoisoindoline-4-carboxylic acid, 97%, 97% (CAS 935269-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H43F-100mg |
| cas | 935269-27-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 971.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-oxo-1,2-dihydroisoindole-4-carboxylic acid (CAS 935269-27-5) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 3-oxo-1,2-dihydroisoindole-4-carboxylic acid. InChIKey: SONYZPKBPBFLSS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-oxo-1,2-dihydroisoindole-4-carboxylic acid |
| InChIKey | SONYZPKBPBFLSS-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)C(=O)O)C(=O)N1 |
Computed by PubChem (NCBI)