cas: 39515-51-0 — see every product listed under this CAS number, including other names
3-Phenoxybenzaldehyde 95% (CAS 39515-51-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A671060-25g |
| cas | 39515-51-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 292.50 Pln | |
| Ambeed | 500g | 665.19 Pln | |
| Ambeed | 1000g | 1243.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A671060 |
3-phenoxybenzaldehyde (CAS 39515-51-0) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 3-phenoxybenzaldehyde. InChIKey: MRLGCTNJRREZHZ-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3-phenoxybenzaldehyde |
| InChIKey | MRLGCTNJRREZHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)