cas: 39515-51-0 — see every product listed under this CAS number, including other names
3-Phenoxybenzaldehyde, 99.90% (CAS 39515-51-0) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-Y0641-25 g |
| cas | 39515-51-0 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 263.96 Pln | |
| MedChemExpress | 50 g | 310.40 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.90% |
3-phenoxybenzaldehyde (CAS 39515-51-0) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 3-phenoxybenzaldehyde. InChIKey: MRLGCTNJRREZHZ-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3-phenoxybenzaldehyde |
| InChIKey | MRLGCTNJRREZHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)