cas: 39515-51-0 — see every product listed under this CAS number, including other names
3-Phenoxybenzaldehyde (CAS 39515-51-0) is a chemical reagent available from Chemat. Available pack sizes: 0,1kg, 0,25kg, 0,5kg, 1kg, 1x100mg, 1g, 5g, 10g. Offered by: Biosynth, HPC Standards, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | FP26888-0,1kg |
| cas | 39515-51-0 |
| size | 0,1kg |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 0,1kg | price on request | |
| Biosynth | 0,25kg | price on request | |
| Biosynth | 0,5kg | price on request | |
| Biosynth | 1kg | price on request | |
| HPC Standards | 1x100mg | 306.92 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 112.48 Pln | |
| Fluorochem | 25g | 133.30 Pln | |
| Fluorochem | 100g | 221.81 Pln | |
| Fluorochem | 500g | 612.30 Pln |
| category | Research Chemicals |
|---|---|
| purity | No data |
| delivery time | 1-2 weeks |
3-phenoxybenzaldehyde (CAS 39515-51-0) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 3-phenoxybenzaldehyde. InChIKey: MRLGCTNJRREZHZ-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3-phenoxybenzaldehyde |
| InChIKey | MRLGCTNJRREZHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)