cas: 39515-51-0 — see every product listed under this CAS number, including other names
3-Phenoxybenzaldehyde, >97.0%(GC) (CAS 39515-51-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P0960-25G |
| cas | 39515-51-0 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 123.26 Pln | |
| TCI | 500g | 1150.97 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
3-phenoxybenzaldehyde (CAS 39515-51-0) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 3-phenoxybenzaldehyde. InChIKey: MRLGCTNJRREZHZ-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3-phenoxybenzaldehyde |
| InChIKey | MRLGCTNJRREZHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)