cas: 28737-32-8 — see every product listed under this CAS number, including other names
3-chloro-1H-indole-2-carboxylic acid, 97% (CAS 28737-32-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F312781-250MG |
| cas | 28737-32-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 539.41 Pln | |
| Fluorochem | 2.5g | 1158.98 Pln | |
| Fluorochem | 5g | 2262.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-chloro-1H-indole-2-carboxylic acid (CAS 28737-32-8) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 3-chloro-1H-indole-2-carboxylic acid. InChIKey: MVEQAUFZXJDLOP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 3-chloro-1H-indole-2-carboxylic acid |
| InChIKey | MVEQAUFZXJDLOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C(=O)O)Cl |
Computed by PubChem (NCBI)