Products 96187-75-6
CAS 96187-75-6 appears in our catalog under these names: 6-Chloro-5-methylisatin, 95%, 6-Chloro-5-methylindoline-2,3-dione 97%, 6-Chloro-5-methylindoline-2,3-dione, 98%, 6-Chloro-5-methylindoline-2,3-dione, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg.
6-chloro-5-methyl-1H-indole-2,3-dione (CAS 96187-75-6) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 6-chloro-5-methyl-1H-indole-2,3-dione. InChIKey: PDNPCCKRVLBASB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 6-chloro-5-methyl-1H-indole-2,3-dione |
| InChIKey | PDNPCCKRVLBASB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)NC(=O)C2=O |
Computed by PubChem (NCBI)