Products 23872-36-8
CAS 23872-36-8 appears in our catalog under these names: 4-Chloroindole-3-carboxylic acid, 95%, 4–Chloro–1H–indole–3–carboxylic acid, 4-Chloro-1H-indole-3-carboxylic acid 95%, 4-Chloro-1H-indole-3-carboxylic acid, 95%, 95%, 4-Chloro-1H-indole-3-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-chloro-1H-indole-3-carboxylic acid (CAS 23872-36-8) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 4-chloro-1H-indole-3-carboxylic acid. InChIKey: DRKHLIJRUYVIOY-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 4-chloro-1H-indole-3-carboxylic acid |
| InChIKey | DRKHLIJRUYVIOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)