CAS 914106-36-8 appears in our catalog under these names: Methyl 2-chloro-5-cyanobenzoate, 98%, Methyl 2-chloro-5-cyanobenzoate, 98%, 98%, Methyl 2-chloro-5-cyanobenzoate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl 2-chloro-5-cyanobenzoate (CAS 914106-36-8) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: methyl 2-chloro-5-cyanobenzoate. InChIKey: RGLQGCVEXOWXEK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | methyl 2-chloro-5-cyanobenzoate |
| InChIKey | RGLQGCVEXOWXEK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C#N)Cl |
Computed by PubChem (NCBI)