Products 34841-48-0
CAS 34841-48-0 appears in our catalog under these names: 2-(3-Chloro-4-cyanophenyl)acetic acid, 96%, 2–(3–Chloro–4–cyanophenyl)acetic acid, 2-(3-Chloro-4-cyanophenyl)acetic acid 95%, 2-(3-Chloro-4-cyanophenyl)acetic acid, 95%, 95%, 2-(3-Chloro-4-cyanophenyl)acetic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-(3-chloro-4-cyanophenyl)acetic acid (CAS 34841-48-0) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 2-(3-chloro-4-cyanophenyl)acetic acid. InChIKey: CINFDMVPHNPKFR-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 2-(3-chloro-4-cyanophenyl)acetic acid |
| InChIKey | CINFDMVPHNPKFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)Cl)C#N |
Computed by PubChem (NCBI)