CAS 862588-73-6 appears in our catalog under these names: 3-(4-Chlorophenyl)-1,2-oxazol-5-ol, 97%, 3-(4-Chlorophenyl)-1,2-oxazol-5-ol, ≥97%, ≥97%, 3-(4-chlorophenyl)-1,2-oxazol-5-ol, ≥97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-(4-chlorophenyl)-2H-1,2-oxazol-5-one (CAS 862588-73-6) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 3-(4-chlorophenyl)-2H-1,2-oxazol-5-one. InChIKey: ITVJGZHBGBXTFV-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2H-1,2-oxazol-5-one |
| InChIKey | ITVJGZHBGBXTFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)ON2)Cl |
Computed by PubChem (NCBI)