Products 6374-90-9
CAS 6374-90-9 appears in our catalog under these names: 6-Chloro-7-methyl isatin, 95%, 6-Chloro-7-methylindoline-2，3-dione, 97%, 97%, 6-chloro-7-methyl-1H-indole-2,3-dione, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg, 500mg.
6-chloro-7-methyl-1H-indole-2,3-dione (CAS 6374-90-9) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 6-chloro-7-methyl-1H-indole-2,3-dione. InChIKey: SFWRUGVSPIELCW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 6-chloro-7-methyl-1H-indole-2,3-dione |
| InChIKey | SFWRUGVSPIELCW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC(=O)C2=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
6-chloro-7-methyl-2,3-dihydro-1H-indole-2,3-dione, 6-chloro-7-methyl-1H-indole-2,3-dione, 6-Chloro-7-methyl isatin, 6-chloro-7-methylindoline-2,3-dione, 1H-Indole-2,3-dione, 6-chloro-7-methyl-, 6-Chloro-7-methylisatin, 6-chloro-7-methyl-indoline-2,3-dione, 1H-Indole-2,3-dione,6-chloro-7-methyl-, Isatin-based compound, 57, SFWRUGVSPIELCW-UHFFFAOYSA-N