Products 28737-32-8
CAS 28737-32-8 appears in our catalog under these names: 3-Chloro-1h-indole-2-carboxylic acid, 95%, 3–Chloroindole–2–carboxylic Acid, 3-Chloroindole-2-carboxylic Acid, >98.0%(T), 3-chloro-1H-indole-2-carboxylic acid, 97%, 97%, 3-chloro-1H-indole-2-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 2.5g.
3-chloro-1H-indole-2-carboxylic acid (CAS 28737-32-8) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 3-chloro-1H-indole-2-carboxylic acid. InChIKey: MVEQAUFZXJDLOP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 3-chloro-1H-indole-2-carboxylic acid |
| InChIKey | MVEQAUFZXJDLOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C(=O)O)Cl |
Computed by PubChem (NCBI)