CAS 1900-41-0 appears in our catalog under these names: 8-Chloro-4-hydroxyquinolin-2(1h)-one, 95%, 8-Chloro-2-hydroxy-1h-quinolin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
8-chloro-4-hydroxy-1H-quinolin-2-one (CAS 1900-41-0) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 8-chloro-4-hydroxy-1H-quinolin-2-one. InChIKey: OECNFSGXQMTYMK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 8-chloro-4-hydroxy-1H-quinolin-2-one |
| InChIKey | OECNFSGXQMTYMK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC(=O)C=C2O |
Computed by PubChem (NCBI)