cas: 2623-33-8 — see every product listed under this CAS number, including other names
4'-Acetoxyacetanilide, >99.0%(HPLC)(N) (CAS 2623-33-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0067-5G |
| cas | 2623-33-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 290.45 Pln | |
| TCI | 25g | 914.94 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(HPLC)(N) |
(4-acetamidophenyl) acetate (CAS 2623-33-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (4-acetamidophenyl) acetate. InChIKey: UJAOSPFULOFZRR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (4-acetamidophenyl) acetate |
| InChIKey | UJAOSPFULOFZRR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC(=O)C |
Computed by PubChem (NCBI)