cas: 2623-33-8 — see every product listed under this CAS number, including other names
4-Acetamidophenyl acetate, 97% (CAS 2623-33-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F544578-5G |
| cas | 2623-33-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 409.25 Pln | |
| Fluorochem | 100g | 1466.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(4-acetamidophenyl) acetate (CAS 2623-33-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (4-acetamidophenyl) acetate. InChIKey: UJAOSPFULOFZRR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (4-acetamidophenyl) acetate |
| InChIKey | UJAOSPFULOFZRR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC(=O)C |
Computed by PubChem (NCBI)