cas: 2623-33-8 — see every product listed under this CAS number, including other names
4-Acetamidophenyl acetate, 97.0% (CAS 2623-33-8) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 25 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-66004-10mM/1mL |
| cas | 2623-33-8 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 25 g | 551.89 Pln | |
| MedChemExpress | 5 g | 263.96 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.0% |
(4-acetamidophenyl) acetate (CAS 2623-33-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (4-acetamidophenyl) acetate. InChIKey: UJAOSPFULOFZRR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (4-acetamidophenyl) acetate |
| InChIKey | UJAOSPFULOFZRR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC(=O)C |
Computed by PubChem (NCBI)