Products 2623-33-8
CAS 2623-33-8 appears in our catalog under these names: p-Acetoxyacetanilide, 98%, Paracetamol (Acetaminophen) EP Impurity H, Paracetamol Impurity H（EP）, Acetaminophen Acetate (Acetaminophen Impurity), >95% (HPLC), 4-(Acetylamino)phenyl Acetate (N,O-Diacetyl-4-aminophenol). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, LoGiCal. Available pack sizes: 25g, 5g, 1g, on request, 500mg, 25mg, 100mg, 10mg.
(4-acetamidophenyl) acetate (CAS 2623-33-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (4-acetamidophenyl) acetate. InChIKey: UJAOSPFULOFZRR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (4-acetamidophenyl) acetate |
| InChIKey | UJAOSPFULOFZRR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC(=O)C |
Computed by PubChem (NCBI)