cas: 222180-20-3 — see every product listed under this CAS number, including other names
4'-Formyl-[1,1'-biphenyl]-3-carboxylic acid, 98%, 98% (CAS 222180-20-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LGJ-250mg |
| cas | 222180-20-3 |
| size | 250mg |
| availability | 12.93g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1254.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(4-formylphenyl)benzoic acid (CAS 222180-20-3) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3-(4-formylphenyl)benzoic acid. InChIKey: PLPKINAPTMTZJU-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-(4-formylphenyl)benzoic acid |
| InChIKey | PLPKINAPTMTZJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)