4,4'-(Hexane-3,4-diyl)diphenol, 98%
cas: 5635-50-7 — see every product listed under this CAS number, including other names
4,4'-(Hexane-3,4-diyl)diphenol, 98% (CAS 5635-50-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A854584-250mg |
| cas | 5635-50-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1254.81 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1538.00 Pln | |
| BLDpharm | 250mg | 197.73 Pln | |
| BLDpharm | 1g | 403.22 Pln | |
| BLDpharm | 5g | 1236.26 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-[4-(4-hydroxyphenyl)hexan-3-yl]phenol (CAS 5635-50-7) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: 4-[4-(4-hydroxyphenyl)hexan-3-yl]phenol. InChIKey: PBBGSZCBWVPOOL-UHFFFAOYSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 4-[4-(4-hydroxyphenyl)hexan-3-yl]phenol |
| InChIKey | PBBGSZCBWVPOOL-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)O)C(CC)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)
