Products 1215476-12-2
CAS 1215476-12-2 appears in our catalog under these names: Hexestrol-d6, (Rac)–Hexestrol–d6, (Rac)-Hexestrol-d6. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
4-[1,1,1,6,6,6-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol (CAS 1215476-12-2) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 276.4 g/mol. IUPAC name: 4-[1,1,1,6,6,6-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol. InChIKey: PBBGSZCBWVPOOL-WFGJKAKNSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | 4-[1,1,1,6,6,6-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol |
| InChIKey | PBBGSZCBWVPOOL-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])CC(C1=CC=C(C=C1)O)C(CC([2H])([2H])[2H])C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)