CAS 1189950-25-1 appears in our catalog under these names: (Rac)–Hexestrol–d4, Hexestrol-d4, >95% (HPLC), Hexestrol-d4, (Rac)-Hexestrol-d4. Offered by: GLPBio, TRC, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 1 mg.
4-[2,2,5,5-tetradeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol (CAS 1189950-25-1) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 274.4 g/mol. IUPAC name: 4-[2,2,5,5-tetradeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol. InChIKey: PBBGSZCBWVPOOL-KHORGVISSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 4-[2,2,5,5-tetradeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol |
| InChIKey | PBBGSZCBWVPOOL-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C)C(C1=CC=C(C=C1)O)C(C2=CC=C(C=C2)O)C([2H])([2H])C |
Computed by PubChem (NCBI)