Products 1219798-48-7
CAS 1219798-48-7 appears in our catalog under these names: Hexestrol-d6, Hexestrol-d6 (hexane-2,2,3,4,5,5-d6) (meso), Hexestrol D6 (hexane-2,2,3,4,5,5-D6), Hexestrol-d6 (hexane-2,2,3,4,5,5-d6) (meso), 98 atom % D, min 98% Chemical Purity, (Rac)-Hexestrol-d6-1. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, CDN, MedChemExpress. Available pack sizes: on request, 10mg, 5mg, 0,01g, 0,005g, 5 mg, 1 mg.
4-[2,2,3,4,5,5-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol (CAS 1219798-48-7) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 276.4 g/mol. IUPAC name: 4-[2,2,3,4,5,5-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol. InChIKey: PBBGSZCBWVPOOL-WQNCLESNSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | 4-[2,2,3,4,5,5-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol |
| InChIKey | PBBGSZCBWVPOOL-WQNCLESNSA-N |
| SMILES | [2H]C([2H])(C)C([2H])(C1=CC=C(C=C1)O)C([2H])(C2=CC=C(C=C2)O)C([2H])([2H])C |
Computed by PubChem (NCBI)