cas: 58328-31-7 — see every product listed under this CAS number, including other names
4,4'-Di(9H-carbazol-9-yl)-1,1'-biphenyl, 97%, 97% (CAS 58328-31-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144UL-1g |
| cas | 58328-31-7 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 227.60 Pln | |
| Chemat | 25g | 386.00 Pln | |
| Chemat | 100g | 1360.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazole (CAS 58328-31-7) is a chemical compound with the molecular formula C36H24N2 and a molecular weight of 484.6 g/mol. IUPAC name: 9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazole. InChIKey: VFUDMQLBKNMONU-UHFFFAOYSA-N.
| Molecular formula | C36H24N2 |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | 9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazole |
| InChIKey | VFUDMQLBKNMONU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)C5=CC=C(C=C5)N6C7=CC=CC=C7C8=CC=CC=C86 |
Computed by PubChem (NCBI)