cas: 58328-31-7 — see every product listed under this CAS number, including other names
4,4′-Bis(carbazol-9-yl)biphenyl, 95-<97% (CAS 58328-31-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 200g, 300g, 400g, 500g, 600g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC613-95-97-100g |
| cas | 58328-31-7 |
| size | 100g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 100g | 4212.56 Pln | |
| Hoffman Fine Chemicals | 200g | 7842.78 Pln | |
| Hoffman Fine Chemicals | 300g | 9348.46 Pln | |
| Hoffman Fine Chemicals | 400g | 10554.28 Pln | |
| Hoffman Fine Chemicals | 500g | 11836.66 Pln | |
| Hoffman Fine Chemicals | 600g | 12761.76 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazole (CAS 58328-31-7) is a chemical compound with the molecular formula C36H24N2 and a molecular weight of 484.6 g/mol. IUPAC name: 9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazole. InChIKey: VFUDMQLBKNMONU-UHFFFAOYSA-N.
| Molecular formula | C36H24N2 |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | 9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazole |
| InChIKey | VFUDMQLBKNMONU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)C5=CC=C(C=C5)N6C7=CC=CC=C7C8=CC=CC=C86 |
Computed by PubChem (NCBI)