cas: 58328-31-7 — see every product listed under this CAS number, including other names
4,4-Di(9H-carbazol-9-yl)-1,1-biphenyl, 98% (CAS 58328-31-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F544885-5G |
| cas | 58328-31-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 10g | 253.05 Pln | |
| Fluorochem | 25g | 502.97 Pln | |
| Fluorochem | 100g | 1815.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazole (CAS 58328-31-7) is a chemical compound with the molecular formula C36H24N2 and a molecular weight of 484.6 g/mol. IUPAC name: 9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazole. InChIKey: VFUDMQLBKNMONU-UHFFFAOYSA-N.
| Molecular formula | C36H24N2 |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | 9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazole |
| InChIKey | VFUDMQLBKNMONU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)C5=CC=C(C=C5)N6C7=CC=CC=C7C8=CC=CC=C86 |
Computed by PubChem (NCBI)