Products 3457-48-5
CAS 3457-48-5 appears in our catalog under these names: 4,4’–Dimethylbenzil, 4,4'-Dimethylbenzil, 98% , 4,4'-Dimethylbenzil, 4,4'-Dimethylbenzil, >99.0%(GC), 1,2-Di-p-tolylethane-1,2-dione 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 25g, 5g, 1g, 50g, 100g, 250g, 500g, 10g.
1,2-bis(4-methylphenyl)ethane-1,2-dione (CAS 3457-48-5) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 1,2-bis(4-methylphenyl)ethane-1,2-dione. InChIKey: BCWCEHMHCDCJAD-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 1,2-bis(4-methylphenyl)ethane-1,2-dione |
| InChIKey | BCWCEHMHCDCJAD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)
Synonyms:
4,4'-Dimethylbenzil, 1,2-Bis(4-methylphenyl)-1,2-ethanedione, 1,2-Di-p-tolylethane-1,2-dione, 1,2-bis(4-methylphenyl)ethane-1,2-dione, Ethanedione, bis(4-methylphenyl)-, Di-p-tolylethanedione, bis(4-methylphenyl)ethane-1,2-dione, P,p'-dimethylbenzil, 1,2-Di-p-tolyl-ethane-1,2-dione, Benzil-based compound, 18