cas: 53764-99-1 — see every product listed under this CAS number, including other names
4,4,4-Trifluoro-1-(m-tolyl)butane-1,3-dione, 97%, 97% (CAS 53764-99-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DHYP-100mg |
| cas | 53764-99-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1586.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,4,4-trifluoro-1-(3-methylphenyl)butane-1,3-dione (CAS 53764-99-1) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 4,4,4-trifluoro-1-(3-methylphenyl)butane-1,3-dione. InChIKey: VOFWLZQTWRLBTR-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(3-methylphenyl)butane-1,3-dione |
| InChIKey | VOFWLZQTWRLBTR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)