cas: 171364-83-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane, 98%, 98% (CAS 171364-83-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZJE-250mg |
| cas | 171364-83-3 |
| size | 250mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 294.80 Pln | |
| Chemat | 100g | 981.20 Pln | |
| Chemat | 1kg | 4970.00 Pln | |
| Chemat | 5kg | 23356.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane (CAS 171364-83-3) is a chemical compound with the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane. InChIKey: LUWACRUAJXZANC-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane |
| InChIKey | LUWACRUAJXZANC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)