Products 1615247-86-3
CAS 1615247-86-3 is the registry number for (4-(2-Amino-5,8-dioxaspiro[3.4]octan-2-yl)phenyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(2-amino-5,8-dioxaspiro[3.4]octan-2-yl)phenyl]boronic acid (CAS 1615247-86-3) is a chemical compound with the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. IUPAC name: [4-(2-amino-5,8-dioxaspiro[3.4]octan-2-yl)phenyl]boronic acid. InChIKey: GFFNIFPYOJMUKI-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | [4-(2-amino-5,8-dioxaspiro[3.4]octan-2-yl)phenyl]boronic acid |
| InChIKey | GFFNIFPYOJMUKI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2(CC3(C2)OCCO3)N)(O)O |
Computed by PubChem (NCBI)