CAS 190788-59-1 appears in our catalog under these names: 4,4,5,5–Tetramethyl–2–(2–nitrophenyl)–1,3,2–dioxaborolane, 2-Nitrobenzeneboronic acid pinacol ester, 98+% , 4,4,5,5-Tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane, >98.0%(GC)(T), 2-Nitrophenylboronic acid pinacol ester, 97%, 2-Nitrobenzeneboronic acid 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g.
4,4,5,5-tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane (CAS 190788-59-1) is a chemical compound with the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane. InChIKey: VLJYUDGCEKORNG-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane |
| InChIKey | VLJYUDGCEKORNG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)