CAS 2377606-46-5 appears in our catalog under these names: 5-Carboxypyridine-3-boronic acid pinacol ester, 95%, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinic acid. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylic acid (CAS 2377606-46-5) is a chemical compound with the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylic acid. InChIKey: HJTYOQPLTYTEIV-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylic acid |
| InChIKey | HJTYOQPLTYTEIV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)