CAS 2828447-00-1 is the registry number for 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,3]dioxolo[4,5-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 1g, 250mg, 5g.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,3]dioxolo[4,5-b]pyridine (CAS 2828447-00-1) is a chemical compound with the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,3]dioxolo[4,5-b]pyridine. InChIKey: UJZKCSUOWLEUTH-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,3]dioxolo[4,5-b]pyridine |
| InChIKey | UJZKCSUOWLEUTH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)OCO3 |
Computed by PubChem (NCBI)