Products 2271106-93-3
CAS 2271106-93-3 is the registry number for 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylic acid (CAS 2271106-93-3) is a chemical compound with the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylic acid. InChIKey: SGQZPOXXSPZINQ-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylic acid |
| InChIKey | SGQZPOXXSPZINQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)