CAS 171364-83-3 appears in our catalog under these names: 4–Nitrophenylboronic acid pinacol ester, 4-Nitrobenzeneboronic acid pinacol ester, 98% , 4,4,5,5-Tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane, >98.0%(GC), 4,4,5,5-Tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane 98%, 4-NITROPHENYLBORONIC ACID PINACOL ESTER. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 1g, 5g, 250mg, 10g, 500g, 1kg.
4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane (CAS 171364-83-3) is a chemical compound with the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane. InChIKey: LUWACRUAJXZANC-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-nitrophenyl)-1,3,2-dioxaborolane |
| InChIKey | LUWACRUAJXZANC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)