CAS 68716-48-3 appears in our catalog under these names: 3–Nitrophenylboronic acid pinacol ester, 3-Nitrophenylboronic acid pinacol ester, 97%, 4,4,5,5-Tetramethyl-2-(3-nitrophenyl)-1,3,2-dioxaborolane 98%, 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(3-nitrophenyl)-, 98%, 98%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 100g, 10g.
4,4,5,5-tetramethyl-2-(3-nitrophenyl)-1,3,2-dioxaborolane (CAS 68716-48-3) is a chemical compound with the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-nitrophenyl)-1,3,2-dioxaborolane. InChIKey: JWEAFTZTLIGAQU-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-nitrophenyl)-1,3,2-dioxaborolane |
| InChIKey | JWEAFTZTLIGAQU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)