cas: 1432610-24-6 — see every product listed under this CAS number, including other names
4,5-Difluoro-2-formylphenylboronic acid (CAS 1432610-24-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F623095-1G |
| cas | 1432610-24-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4735.85 Pln |
| delivery time | 3-4 weeks |
|---|
(4,5-difluoro-2-formylphenyl)boronic acid (CAS 1432610-24-6) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (4,5-difluoro-2-formylphenyl)boronic acid. InChIKey: CDZRCFSCIRPYON-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (4,5-difluoro-2-formylphenyl)boronic acid |
| InChIKey | CDZRCFSCIRPYON-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C=O)F)F)(O)O |
Computed by PubChem (NCBI)