cas: 3088-15-1 — see every product listed under this CAS number, including other names
4,6-Dibenzoylresorcinol, 95%, 95% (CAS 3088-15-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1142K0-250mg |
| cas | 3088-15-1 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 942.80 Pln | |
| Chemat | 25g | 3006.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(5-benzoyl-2,4-dihydroxyphenyl)-phenylmethanone (CAS 3088-15-1) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: (5-benzoyl-2,4-dihydroxyphenyl)-phenylmethanone. InChIKey: GOZHNJTXLALKRL-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | (5-benzoyl-2,4-dihydroxyphenyl)-phenylmethanone |
| InChIKey | GOZHNJTXLALKRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2O)O)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)